C18H14ClN5O3S2 — CID 15650516
4-chloro-N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 15650516) has the molecular formula C18H14ClN5O3S2 and a molecular weight of 447.93 g/mol. Its IUPAC name is 4-chloro-N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-chloro-N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 15650516 |
| Molecular Formula | C18H14ClN5O3S2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 4-chloro-N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN5O3S2/c19-13-4-2-12(3-5-13)16(25)23-18(28)22-14-6-8-15(9-7-14)29(26,27)24-17-20-10-1-11-21-17/h1-11H,(H,20,21,24)(H2,22,23,25,28) |
| InChIKey | HNXRNVIOVADQKE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|