C18H21FN2O5 — CID 156505564
2-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetic acid (PubChem CID 156505564) has the molecular formula C18H21FN2O5 and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 156505564 |
| Molecular Formula | C18H21FN2O5 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1(O)CCN(c2ccc(C3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C18H21FN2O5/c19-13-9-11(12-2-4-15(22)20-17(12)25)1-3-14(13)21-7-5-18(26,6-8-21)10-16(23)24/h1,3,9,12,26H,2,4-8,10H2,(H,23,24)(H,20,22,25) |
| InChIKey | OLCAYBMXNNHVIY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|