C23H32FN3O5 — CID 156505600
tert-butyl 2-[(4R)-1-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]-4-hydroxyazepan-4-yl]acetate (PubChem CID 156505600) has the molecular formula C23H32FN3O5 and a molecular weight of 449.52 g/mol. Its IUPAC name is tert-butyl 2-[(4R)-1-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]-4-hydroxyazepan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R)-1-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]-4-hydroxyazepan-4-yl]acetate |
|---|---|
| PubChem CID | 156505600 |
| Molecular Formula | C23H32FN3O5 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | tert-butyl 2-[(4R)-1-[4-[[(3R)-2,6-dioxopiperidin-3-yl]amino]-2-fluorophenyl]-4-hydroxyazepan-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@]1(O)CCCN(c2ccc(N[C@@H]3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C23H32FN3O5/c1-22(2,3)32-20(29)14-23(31)9-4-11-27(12-10-23)18-7-5-15(13-16(18)24)25-17-6-8-19(28)26-21(17)30/h5,7,13,17,25,31H,4,6,8-12,14H2,1-3H3,(H,26,28,30)/t17-,23-/m1/s1 |
| InChIKey | LWRVZYMRFZYJRV-UZUQRXQVSA-N |
| XLogP | 2.50 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|