C22H29FN2O5 — CID 156505841
tert-butyl 2-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate (PubChem CID 156505841) has the molecular formula C22H29FN2O5 and a molecular weight of 420.48 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 156505841 |
| Molecular Formula | C22H29FN2O5 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | tert-butyl 2-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(O)CCN(c2ccc(C3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C22H29FN2O5/c1-21(2,3)30-19(27)13-22(29)8-10-25(11-9-22)17-6-4-14(12-16(17)23)15-5-7-18(26)24-20(15)28/h4,6,12,15,29H,5,7-11,13H2,1-3H3,(H,24,26,28) |
| InChIKey | ZGUFQMRWMFJFJT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|