C19H24FN3O5 — CID 156505842
2-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-4-hydroxyazepan-4-yl]acetic acid (PubChem CID 156505842) has the molecular formula C19H24FN3O5 and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-4-hydroxyazepan-4-yl]acetic acid.
| Compound Name | 2-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-4-hydroxyazepan-4-yl]acetic acid |
|---|---|
| PubChem CID | 156505842 |
| Molecular Formula | C19H24FN3O5 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[1-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]-4-hydroxyazepan-4-yl]acetic acid |
| SMILES | O=C(O)CC1(O)CCCN(c2ccc(NC3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C19H24FN3O5/c20-13-10-12(21-14-3-5-16(24)22-18(14)27)2-4-15(13)23-8-1-6-19(28,7-9-23)11-17(25)26/h2,4,10,14,21,28H,1,3,5-9,11H2,(H,25,26)(H,22,24,27) |
| InChIKey | VORFQNIGEKBIFJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|