C36H39F2N3O5 — CID 156505942
tert-butyl 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]-4-hydroxypiperidin-4-yl]acetate (PubChem CID 156505942) has the molecular formula C36H39F2N3O5 and a molecular weight of 631.72 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]-4-hydroxypiperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]-4-hydroxypiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 156505942 |
| Molecular Formula | C36H39F2N3O5 |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | tert-butyl 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]-4-hydroxypiperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(O)CCN(c2c(F)cc(Nc3ccc(OCc4ccccc4)nc3OCc3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C36H39F2N3O5/c1-35(2,3)46-32(42)22-36(43)16-18-41(19-17-36)33-28(37)20-27(21-29(33)38)39-30-14-15-31(44-23-25-10-6-4-7-11-25)40-34(30)45-24-26-12-8-5-9-13-26/h4-15,20-21,39,43H,16-19,22-24H2,1-3H3 |
| InChIKey | VYYOFVFUMUHEBT-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|