C8H16N2 — CID 15650611
(4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline (PubChem CID 15650611) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline.
| Compound Name | (4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline |
|---|---|
| PubChem CID | 15650611 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline |
| SMILES | C1CC[C@H]2NCCN[C@@H]2C1 |
| InChI | InChI=1S/C8H16N2/c1-2-4-8-7(3-1)9-5-6-10-8/h7-10H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | MDEXMBGPIZUUBI-HTQZYQBOSA-N |
| XLogP | 0.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |