C32H31F2N3O5 — CID 156506239
2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]-4-hydroxypiperidin-4-yl]acetic acid (PubChem CID 156506239) has the molecular formula C32H31F2N3O5 and a molecular weight of 575.61 g/mol. Its IUPAC name is 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]-4-hydroxypiperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]-4-hydroxypiperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 156506239 |
| Molecular Formula | C32H31F2N3O5 |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]-4-hydroxypiperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1(O)CCN(c2c(F)cc(Nc3ccc(OCc4ccccc4)nc3OCc3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C32H31F2N3O5/c33-25-17-24(18-26(34)30(25)37-15-13-32(40,14-16-37)19-29(38)39)35-27-11-12-28(41-20-22-7-3-1-4-8-22)36-31(27)42-21-23-9-5-2-6-10-23/h1-12,17-18,35,40H,13-16,19-21H2,(H,38,39) |
| InChIKey | JRIJRHGBVYKZQM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|