C14H9ClF3NO2 — CID 156507011
methyl 2-amino-5-chloro-4-(2,4,6-trifluorophenyl)benzoate (PubChem CID 156507011) has the molecular formula C14H9ClF3NO2 and a molecular weight of 315.68 g/mol. Its IUPAC name is methyl 2-amino-5-chloro-4-(2,4,6-trifluorophenyl)benzoate.
| Compound Name | methyl 2-amino-5-chloro-4-(2,4,6-trifluorophenyl)benzoate |
|---|---|
| PubChem CID | 156507011 |
| Molecular Formula | C14H9ClF3NO2 |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 2-amino-5-chloro-4-(2,4,6-trifluorophenyl)benzoate |
| SMILES | COC(=O)c1cc(Cl)c(-c2c(F)cc(F)cc2F)cc1N |
| InChI | InChI=1S/C14H9ClF3NO2/c1-21-14(20)8-4-9(15)7(5-12(8)19)13-10(17)2-6(16)3-11(13)18/h2-5H,19H2,1H3 |
| InChIKey | UMLFQPZOHVVTLC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|