About 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one
1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one (PubChem CID 156507050) has the molecular formula C27H22BrN3O3
and a molecular weight of 516.40 g/mol. Its IUPAC name is 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one.
Molecular Properties
| Compound Name | 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one |
| PubChem CID | 156507050 |
| Molecular Formula | C27H22BrN3O3 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2cccc(Br)c21 |
| InChI | InChI=1S/C27H22BrN3O3/c1-30-25-21(28)13-8-14-22(25)31(27(30)32)23-15-16-24(33-17-19-9-4-2-5-10-19)29-26(23)34-18-20-11-6-3-7-12-20/h2-16H,17-18H2,1H3 |
| InChIKey | CXVQBQBGHUDVBP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one?
The IUPAC name of 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one (CID 156507050) is 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one.
What is the SMILES notation for 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one?
The canonical SMILES for 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one is Cn1c(=O)n(-c2ccc(OCc3ccccc3)nc2OCc2ccccc2)c2cccc(Br)c21.
What is the InChIKey of 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one?
The InChIKey is CXVQBQBGHUDVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22BrN3O3/c1-30-25-21(28)13-8-14-22(25)31(27(30)32)23-15-16-24(33-17-19-9-4-2-5-10-19)29-26(23)34-18-20-11-6-3-7-12-20/h2-16H,17-18H2,1H3.
What are the key properties of 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one?
1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one has a molecular weight of 516.40 g/mol, XLogP of 5.64, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-bis(phenylmethoxy)-3-pyridinyl]-4-bromo-3-methylbenzimidazol-2-one is sourced from PubChem (CID 156507050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).