C25H21F5N4O2S — CID 156507105
8-(2,4-difluorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 156507105) has the molecular formula C25H21F5N4O2S and a molecular weight of 536.53 g/mol. Its IUPAC name is 8-(2,4-difluorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 8-(2,4-difluorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 156507105 |
| Molecular Formula | C25H21F5N4O2S |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 8-(2,4-difluorophenyl)-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-7-(trifluoromethyl)-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n3c4c(c(-c5ccc(F)cc5F)c(C(F)(F)F)cc24)SCC3)[C@@H](C)C1 |
| InChI | InChI=1S/C25H21F5N4O2S/c1-3-19(35)32-6-7-33(13(2)12-32)23-16-11-17(25(28,29)30)20(15-5-4-14(26)10-18(15)27)22-21(16)34(8-9-37-22)24(36)31-23/h3-5,10-11,13H,1,6-9,12H2,2H3/t13-/m0/s1 |
| InChIKey | CZJLLJGNLOJJSG-ZDUSSCGKSA-N |
| XLogP | 4.69 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|