About tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate
tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate (PubChem CID 156507155) has the molecular formula C14H16FN3O3
and a molecular weight of 293.30 g/mol. Its IUPAC name is tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate |
| PubChem CID | 156507155 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)Cn1ncn(-c2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C14H16FN3O3/c1-14(2,3)21-12(19)8-18-13(20)17(9-16-18)11-6-4-10(15)5-7-11/h4-7,9H,8H2,1-3H3 |
| InChIKey | HPVHDQIRZBOXHG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate?
The IUPAC name of tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate (CID 156507155) is tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate.
What is the SMILES notation for tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate?
The canonical SMILES for tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate is CC(C)(C)OC(=O)Cn1ncn(-c2ccc(F)cc2)c1=O.
What is the InChIKey of tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate?
The InChIKey is HPVHDQIRZBOXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN3O3/c1-14(2,3)21-12(19)8-18-13(20)17(9-16-18)11-6-4-10(15)5-7-11/h4-7,9H,8H2,1-3H3.
What are the key properties of tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate?
tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate has a molecular weight of 293.30 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[4-(4-fluorophenyl)-5-oxo-1,2,4-triazol-1-yl]acetate is sourced from PubChem (CID 156507155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).