methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate

C10H11NO4S2 — CID 156507369

IUPACmethyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate
SMILESCOC(=O)N1c2ccccc2SC1S(C)(=O)=O
InChIInChI=1S/C10H11NO4S2/c1-15-9(12)11-7-5-3-4-6-8(7)16-10(11)17(2,13)14/h3-6,10H,1-2H3
InChIKeyDCAGZDMGBUYJCP-UHFFFAOYSA-N
MW273.34 g/mol
LogP1.69
Rot. Bonds1

About methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate

methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate (PubChem CID 156507369) has the molecular formula C10H11NO4S2 and a molecular weight of 273.34 g/mol. Its IUPAC name is methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate.

Molecular Properties

Compound Namemethyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate
PubChem CID156507369
Molecular FormulaC10H11NO4S2
Molecular Weight273.34 g/mol
Exact Mass273.01
IUPAC Namemethyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate
SMILESCOC(=O)N1c2ccccc2SC1S(C)(=O)=O
InChIInChI=1S/C10H11NO4S2/c1-15-9(12)11-7-5-3-4-6-8(7)16-10(11)17(2,13)14/h3-6,10H,1-2H3
InChIKeyDCAGZDMGBUYJCP-UHFFFAOYSA-N
XLogP1.69
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.34
LogP ≤ 51.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate?
The IUPAC name of methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate (CID 156507369) is methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate.
What is the SMILES notation for methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate?
The canonical SMILES for methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate is COC(=O)N1c2ccccc2SC1S(C)(=O)=O.
What is the InChIKey of methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate?
The InChIKey is DCAGZDMGBUYJCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4S2/c1-15-9(12)11-7-5-3-4-6-8(7)16-10(11)17(2,13)14/h3-6,10H,1-2H3.
What are the key properties of methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate?
methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate has a molecular weight of 273.34 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylsulfonyl-2H-1,3-benzothiazole-3-carboxylate is sourced from PubChem (CID 156507369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).