C34H37FN6O8S — CID 156507555
3-[5-[1-[4-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxybutyl]piperidin-4-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 156507555) has the molecular formula C34H37FN6O8S and a molecular weight of 708.77 g/mol. Its IUPAC name is 3-[5-[1-[4-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxybutyl]piperidin-4-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[1-[4-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxybutyl]piperidin-4-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156507555 |
| Molecular Formula | C34H37FN6O8S |
| Molecular Weight | 708.77 g/mol |
| Exact Mass | 708.24 |
| IUPAC Name | 3-[5-[1-[4-[8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]oxybutyl]piperidin-4-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C3CCN(CCCCOc4ccc5cc(O)c(N6CC(=O)NS6(=O)=O)c(F)c5c4)CC3)cc21 |
| InChI | InChI=1S/C34H37FN6O8S/c1-38-27-16-21(5-7-25(27)41(34(38)46)26-8-9-29(43)36-33(26)45)20-10-13-39(14-11-20)12-2-3-15-49-23-6-4-22-17-28(42)32(31(35)24(22)18-23)40-19-30(44)37-50(40,47)48/h4-7,16-18,20,26,42H,2-3,8-15,19H2,1H3,(H,37,44)(H,36,43,45) |
| InChIKey | LYOCGAQWGNEXQX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 172.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|