C16H13F2N5O3S — CID 156507731
4-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-thiazol-2-yl]methyl]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 156507731) has the molecular formula C16H13F2N5O3S and a molecular weight of 393.38 g/mol. Its IUPAC name is 4-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-thiazol-2-yl]methyl]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 4-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-thiazol-2-yl]methyl]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 156507731 |
| Molecular Formula | C16H13F2N5O3S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 4-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-thiazol-2-yl]methyl]-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC1(C)Oc2cccnc2N(Cc2ncc(-c3nnc(C(F)F)o3)s2)C1=O |
| InChI | InChI=1S/C16H13F2N5O3S/c1-16(2)15(24)23(12-8(26-16)4-3-5-19-12)7-10-20-6-9(27-10)13-21-22-14(25-13)11(17)18/h3-6,11H,7H2,1-2H3 |
| InChIKey | JAVAYLLPYUOHGD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |