C24H27N5O5 — CID 156508005
tert-butyl N-[4-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]amino]phenyl]carbamate (PubChem CID 156508005) has the molecular formula C24H27N5O5 and a molecular weight of 465.51 g/mol. Its IUPAC name is tert-butyl N-[4-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 156508005 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | tert-butyl N-[4-[[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]amino]phenyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(Nc3ccc(NC(=O)OC(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C24H27N5O5/c1-24(2,3)34-22(32)26-15-7-5-14(6-8-15)25-16-9-10-17-19(13-16)28(4)23(33)29(17)18-11-12-20(30)27-21(18)31/h5-10,13,18,25H,11-12H2,1-4H3,(H,26,32)(H,27,30,31) |
| InChIKey | NOBLCEGILWJUHZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|