C24H25FN4O4 — CID 156508026
2-[2-[[4-[[2-(2-amino-2-iminoethoxy)phenoxy]methyl]-3-fluorophenyl]methoxy]phenoxy]ethanimidamide (PubChem CID 156508026) has the molecular formula C24H25FN4O4 and a molecular weight of 452.49 g/mol. Its IUPAC name is 2-[2-[[4-[[2-(2-amino-2-iminoethoxy)phenoxy]methyl]-3-fluorophenyl]methoxy]phenoxy]ethanimidamide.
| Compound Name | 2-[2-[[4-[[2-(2-amino-2-iminoethoxy)phenoxy]methyl]-3-fluorophenyl]methoxy]phenoxy]ethanimidamide |
|---|---|
| PubChem CID | 156508026 |
| Molecular Formula | C24H25FN4O4 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-[2-[[4-[[2-(2-amino-2-iminoethoxy)phenoxy]methyl]-3-fluorophenyl]methoxy]phenoxy]ethanimidamide |
| SMILES | [H]/N=C(\N)COc1ccccc1OCc1ccc(COc2ccccc2OC/C(N)=N/[H])c(F)c1 |
| InChI | InChI=1S/C24H25FN4O4/c25-18-11-16(12-30-19-5-1-3-7-21(19)32-14-23(26)27)9-10-17(18)13-31-20-6-2-4-8-22(20)33-15-24(28)29/h1-11H,12-15H2,(H3,26,27)(H3,28,29) |
| InChIKey | YQKCRCCHMMNIIE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|