C19H23N4O9S- — CID 156508967
(1E,2R,3S)-1-[[(2S)-2-[(3,4-dihydroxybenzoyl)amino]propanoyl]hydrazinylidene]-4-hydroxy-2-methyl-3-[(2R)-2-methyl-4-oxoazetidin-1-yl]-4-oxobutane-2-sulfinate (PubChem CID 156508967) has the molecular formula C19H23N4O9S- and a molecular weight of 483.48 g/mol. Its IUPAC name is (1E,2R,3S)-1-[[(2S)-2-[(3,4-dihydroxybenzoyl)amino]propanoyl]hydrazinylidene]-4-hydroxy-2-methyl-3-[(2R)-2-methyl-4-oxoazetidin-1-yl]-4-oxobutane-2-sulfinate.
| Compound Name | (1E,2R,3S)-1-[[(2S)-2-[(3,4-dihydroxybenzoyl)amino]propanoyl]hydrazinylidene]-4-hydroxy-2-methyl-3-[(2R)-2-methyl-4-oxoazetidin-1-yl]-4-oxobutane-2-sulfinate |
|---|---|
| PubChem CID | 156508967 |
| Molecular Formula | C19H23N4O9S- |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | (1E,2R,3S)-1-[[(2S)-2-[(3,4-dihydroxybenzoyl)amino]propanoyl]hydrazinylidene]-4-hydroxy-2-methyl-3-[(2R)-2-methyl-4-oxoazetidin-1-yl]-4-oxobutane-2-sulfinate |
| SMILES | C[C@H](NC(=O)c1ccc(O)c(O)c1)C(=O)N/N=C/[C@@](C)([C@H](C(=O)O)N1C(=O)C[C@H]1C)S(=O)[O-] |
| InChI | InChI=1S/C19H24N4O9S/c1-9-6-14(26)23(9)15(18(29)30)19(3,33(31)32)8-20-22-16(27)10(2)21-17(28)11-4-5-12(24)13(25)7-11/h4-5,7-10,15,24-25H,6H2,1-3H3,(H,21,28)(H,22,27)(H,29,30)(H,31,32)/p-1/b20-8+/t9-,10+,15+,19+/m1/s1 |
| InChIKey | YSELBBJLLCQPNB-RFCMLEQXSA-M |
| XLogP | -0.97 |
| TPSA | 208.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|