C35H23N3O — CID 156509356
2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine (PubChem CID 156509356) has the molecular formula C35H23N3O and a molecular weight of 501.59 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine.
| Compound Name | 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine |
|---|---|
| PubChem CID | 156509356 |
| Molecular Formula | C35H23N3O |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine |
| SMILES | c1ccc(-c2nc(-c3cc4ccccc4o3)c(-c3ccccc3)nc2-c2ccc(-c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C35H23N3O/c1-3-10-25(11-4-1)32-33(27-19-17-24(18-20-27)29-15-9-21-36-23-29)37-34(26-12-5-2-6-13-26)35(38-32)31-22-28-14-7-8-16-30(28)39-31/h1-23H |
| InChIKey | VBFQIDODQJIRHG-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |