About 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine
2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine (PubChem CID 156509356) has the molecular formula C35H23N3O
and a molecular weight of 501.59 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine.
Molecular Properties
| Compound Name | 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine |
| PubChem CID | 156509356 |
| Molecular Formula | C35H23N3O |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine |
| SMILES | c1ccc(-c2nc(-c3cc4ccccc4o3)c(-c3ccccc3)nc2-c2ccc(-c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C35H23N3O/c1-3-10-25(11-4-1)32-33(27-19-17-24(18-20-27)29-15-9-21-36-23-29)37-34(26-12-5-2-6-13-26)35(38-32)31-22-28-14-7-8-16-30(28)39-31/h1-23H |
| InChIKey | VBFQIDODQJIRHG-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine?
The IUPAC name of 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine (CID 156509356) is 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine.
What is the SMILES notation for 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine?
The canonical SMILES for 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine is c1ccc(-c2nc(-c3cc4ccccc4o3)c(-c3ccccc3)nc2-c2ccc(-c3cccnc3)cc2)cc1.
What is the InChIKey of 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine?
The InChIKey is VBFQIDODQJIRHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H23N3O/c1-3-10-25(11-4-1)32-33(27-19-17-24(18-20-27)29-15-9-21-36-23-29)37-34(26-12-5-2-6-13-26)35(38-32)31-22-28-14-7-8-16-30(28)39-31/h1-23H.
What are the key properties of 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine?
2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine has a molecular weight of 501.59 g/mol, XLogP of 8.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzofuran-2-yl)-3,6-diphenyl-5-(4-pyridin-3-ylphenyl)pyrazine is sourced from PubChem (CID 156509356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).