C30H43N8O5+ — CID 156509550
3-amino-N-[[1,3-diethyl-5-[1-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]piperidin-4-yl]benzimidazol-1-ium-2-yl]methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide (PubChem CID 156509550) has the molecular formula C30H43N8O5+ and a molecular weight of 595.73 g/mol. Its IUPAC name is 3-amino-N-[[1,3-diethyl-5-[1-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]piperidin-4-yl]benzimidazol-1-ium-2-yl]methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[[1,3-diethyl-5-[1-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]piperidin-4-yl]benzimidazol-1-ium-2-yl]methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 156509550 |
| Molecular Formula | C30H43N8O5+ |
| Molecular Weight | 595.73 g/mol |
| Exact Mass | 595.34 |
| IUPAC Name | 3-amino-N-[[1,3-diethyl-5-[1-[(2S,3S,4R)-2,3,4,6-tetrahydroxyhexyl]piperidin-4-yl]benzimidazol-1-ium-2-yl]methyl]-5H-pyrrolo[2,3-b]pyrazine-2-carboxamide |
| SMILES | CCn1c(CNC(=O)c2nc3cc[nH]c3nc2N)[n+](CC)c2ccc(C3CCN(C[C@H](O)[C@@H](O)[C@H](O)CCO)CC3)cc21 |
| InChI | InChI=1S/C30H42N8O5/c1-3-37-21-6-5-19(18-8-12-36(13-9-18)17-24(41)27(42)23(40)10-14-39)15-22(21)38(4-2)25(37)16-33-30(43)26-28(31)35-29-20(34-26)7-11-32-29/h5-7,11,15,18,23-24,27,39-42H,3-4,8-10,12-14,16-17H2,1-2H3,(H3-,31,32,33,34,35,43)/p+1/t23-,24+,27+/m1/s1 |
| InChIKey | MBYHBFDOJNKYEE-DXBVXKBHSA-O |
| XLogP | 0.40 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.73 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|