C16H21N2O5P — CID 156509853
1-[5-(2,5-dioxopyrrolidin-1-yl)oxy-2,4,4-trimethyl-5-phosphanylidenepentan-2-yl]pyrrole-2,5-dione (PubChem CID 156509853) has the molecular formula C16H21N2O5P and a molecular weight of 352.33 g/mol. Its IUPAC name is 1-[5-(2,5-dioxopyrrolidin-1-yl)oxy-2,4,4-trimethyl-5-phosphanylidenepentan-2-yl]pyrrole-2,5-dione.
| Compound Name | 1-[5-(2,5-dioxopyrrolidin-1-yl)oxy-2,4,4-trimethyl-5-phosphanylidenepentan-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 156509853 |
| Molecular Formula | C16H21N2O5P |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[5-(2,5-dioxopyrrolidin-1-yl)oxy-2,4,4-trimethyl-5-phosphanylidenepentan-2-yl]pyrrole-2,5-dione |
| SMILES | [H]/P=C(\ON1C(=O)CCC1=O)C(C)(C)CC(C)(C)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H21N2O5P/c1-15(2,14(24)23-18-12(21)7-8-13(18)22)9-16(3,4)17-10(19)5-6-11(17)20/h5-6,24H,7-9H2,1-4H3 |
| InChIKey | XCMBCFAPGAKORB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|