About [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate
[2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate (PubChem CID 156509904) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate.
Molecular Properties
| Compound Name | [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate |
| PubChem CID | 156509904 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate |
| SMILES | CCC(=O)OCC(C)(C)C1C=C(C)CCO1 |
| InChI | InChI=1S/C13H22O3/c1-5-12(14)16-9-13(3,4)11-8-10(2)6-7-15-11/h8,11H,5-7,9H2,1-4H3 |
| InChIKey | YHCMSTJTEUGJJD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate?
The IUPAC name of [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate (CID 156509904) is [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate.
What is the SMILES notation for [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate?
The canonical SMILES for [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate is CCC(=O)OCC(C)(C)C1C=C(C)CCO1.
What is the InChIKey of [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate?
The InChIKey is YHCMSTJTEUGJJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O3/c1-5-12(14)16-9-13(3,4)11-8-10(2)6-7-15-11/h8,11H,5-7,9H2,1-4H3.
What are the key properties of [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate?
[2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate has a molecular weight of 226.32 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-2-(4-methyl-3,6-dihydro-2H-pyran-6-yl)propyl] propanoate is sourced from PubChem (CID 156509904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).