C12H21N — CID 156510060
(5Z)-2,4,4,7,7-pentamethyl-2,3-dihydroazocine (PubChem CID 156510060) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (5Z)-2,4,4,7,7-pentamethyl-2,3-dihydroazocine.
| Compound Name | (5Z)-2,4,4,7,7-pentamethyl-2,3-dihydroazocine |
|---|---|
| PubChem CID | 156510060 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (5Z)-2,4,4,7,7-pentamethyl-2,3-dihydroazocine |
| SMILES | CC1CC(C)(C)/C=C\C(C)(C)/C=N\1 |
| InChI | InChI=1S/C12H21N/c1-10-8-11(2,3)6-7-12(4,5)9-13-10/h6-7,9-10H,8H2,1-5H3/b7-6-,13-9- |
| InChIKey | NJRXBTSFWPGINZ-CGHGUHIJSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|