About 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine
4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine (PubChem CID 15651033) has the molecular formula C10H9N5S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine |
| PubChem CID | 15651033 |
| Molecular Formula | C10H9N5S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H9N5S/c11-8-7(9(12)15-14-8)10-13-5-3-1-2-4-6(5)16-10/h1-4H,(H5,11,12,14,15) |
| InChIKey | WXPLYRJRDFOXNS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine?
The IUPAC name of 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine (CID 15651033) is 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine?
The canonical SMILES for 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine is Nc1n[nH]c(N)c1-c1nc2ccccc2s1.
What is the InChIKey of 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine?
The InChIKey is WXPLYRJRDFOXNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5S/c11-8-7(9(12)15-14-8)10-13-5-3-1-2-4-6(5)16-10/h1-4H,(H5,11,12,14,15).
What are the key properties of 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine?
4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine has a molecular weight of 231.28 g/mol, XLogP of 1.85, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yl)-1H-pyrazole-3,5-diamine is sourced from PubChem (CID 15651033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).