C19H20N4S — CID 15651071
N,N-dimethyl-1-(5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepin-1-yl)methanamine (PubChem CID 15651071) has the molecular formula C19H20N4S and a molecular weight of 336.46 g/mol. Its IUPAC name is N,N-dimethyl-1-(5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepin-1-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepin-1-yl)methanamine |
|---|---|
| PubChem CID | 15651071 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N,N-dimethyl-1-(5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepin-1-yl)methanamine |
| SMILES | CN(C)Cc1nnc2n1-c1ccccc1SC(c1ccccc1)C2 |
| InChI | InChI=1S/C19H20N4S/c1-22(2)13-19-21-20-18-12-17(14-8-4-3-5-9-14)24-16-11-7-6-10-15(16)23(18)19/h3-11,17H,12-13H2,1-2H3 |
| InChIKey | IEYMCEIUABRHJY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |