C19H19ClN4S — CID 15651072
1-(9-chloro-5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepin-1-yl)-N,N-dimethylmethanamine (PubChem CID 15651072) has the molecular formula C19H19ClN4S and a molecular weight of 370.91 g/mol. Its IUPAC name is 1-(9-chloro-5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepin-1-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(9-chloro-5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepin-1-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 15651072 |
| Molecular Formula | C19H19ClN4S |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-(9-chloro-5-phenyl-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzothiazepin-1-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1nnc2n1-c1cc(Cl)ccc1SC(c1ccccc1)C2 |
| InChI | InChI=1S/C19H19ClN4S/c1-23(2)12-19-22-21-18-11-17(13-6-4-3-5-7-13)25-16-9-8-14(20)10-15(16)24(18)19/h3-10,17H,11-12H2,1-2H3 |
| InChIKey | HUNPJKPVVDTJMB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |