C27H28F2N2O4 — CID 156510853
3-fluoro-7-[[(1R,2R,6R,8R,10R)-10-fluoro-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl]methyl]quinolin-2-amine (PubChem CID 156510853) has the molecular formula C27H28F2N2O4 and a molecular weight of 482.53 g/mol. Its IUPAC name is 3-fluoro-7-[[(1R,2R,6R,8R,10R)-10-fluoro-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl]methyl]quinolin-2-amine.
| Compound Name | 3-fluoro-7-[[(1R,2R,6R,8R,10R)-10-fluoro-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl]methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 156510853 |
| Molecular Formula | C27H28F2N2O4 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 3-fluoro-7-[[(1R,2R,6R,8R,10R)-10-fluoro-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl]methyl]quinolin-2-amine |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C(Cc4ccc5cc(F)c(N)nc5c4)[C@H](F)C[C@]3(OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C27H28F2N2O4/c1-26(2)34-23-25(35-26)33-22-18(10-16-8-9-17-12-19(28)24(30)31-21(17)11-16)20(29)13-27(22,23)32-14-15-6-4-3-5-7-15/h3-9,11-12,18,20,22-23,25H,10,13-14H2,1-2H3,(H2,30,31)/t18?,20-,22-,23+,25-,27-/m1/s1 |
| InChIKey | FPCQTHLSVPIFQW-LNISQRNUSA-N |
| XLogP | 4.69 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |