C18H19F3N2O4 — CID 156510854
(3R,3aS,6S,6aR)-6-[[2-amino-3-(trifluoromethyl)quinolin-7-yl]methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3,3a-triol (PubChem CID 156510854) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is (3R,3aS,6S,6aR)-6-[[2-amino-3-(trifluoromethyl)quinolin-7-yl]methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3,3a-triol.
| Compound Name | (3R,3aS,6S,6aR)-6-[[2-amino-3-(trifluoromethyl)quinolin-7-yl]methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3,3a-triol |
|---|---|
| PubChem CID | 156510854 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (3R,3aS,6S,6aR)-6-[[2-amino-3-(trifluoromethyl)quinolin-7-yl]methyl]-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-2,3,3a-triol |
| SMILES | Nc1nc2cc(C[C@@H]3CC[C@@]4(O)[C@@H]3OC(O)[C@@H]4O)ccc2cc1C(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O4/c19-18(20,21)11-7-9-2-1-8(6-12(9)23-15(11)22)5-10-3-4-17(26)13(24)16(25)27-14(10)17/h1-2,6-7,10,13-14,16,24-26H,3-5H2,(H2,22,23)/t10-,13-,14+,16?,17-/m0/s1 |
| InChIKey | LNVCHGZFCAVYPU-VNGNCMCHSA-N |
| XLogP | 1.60 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |