C27H27F3N2O4 — CID 156510900
7-[[(1R,2R,6R,8R)-10,10-difluoro-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl]methyl]-3-fluoroquinolin-2-amine (PubChem CID 156510900) has the molecular formula C27H27F3N2O4 and a molecular weight of 500.52 g/mol. Its IUPAC name is 7-[[(1R,2R,6R,8R)-10,10-difluoro-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl]methyl]-3-fluoroquinolin-2-amine.
| Compound Name | 7-[[(1R,2R,6R,8R)-10,10-difluoro-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl]methyl]-3-fluoroquinolin-2-amine |
|---|---|
| PubChem CID | 156510900 |
| Molecular Formula | C27H27F3N2O4 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 7-[[(1R,2R,6R,8R)-10,10-difluoro-4,4-dimethyl-1-phenylmethoxy-3,5,7-trioxatricyclo[6.3.0.02,6]undecan-9-yl]methyl]-3-fluoroquinolin-2-amine |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C(Cc4ccc5cc(F)c(N)nc5c4)C(F)(F)C[C@]3(OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C27H27F3N2O4/c1-25(2)35-22-24(36-25)34-21-18(10-16-8-9-17-12-19(28)23(31)32-20(17)11-16)27(29,30)14-26(21,22)33-13-15-6-4-3-5-7-15/h3-9,11-12,18,21-22,24H,10,13-14H2,1-2H3,(H2,31,32)/t18?,21-,22+,24-,26-/m1/s1 |
| InChIKey | JQMYCAQFJQEDPC-AQQYLQMUSA-N |
| XLogP | 4.99 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |