C24H24F2N6O2 — CID 156510938
(1S,2R,3aR,4S,6aR)-2-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-[(2-amino-3-fluoroquinolin-7-yl)methyl]-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol (PubChem CID 156510938) has the molecular formula C24H24F2N6O2 and a molecular weight of 466.49 g/mol. Its IUPAC name is (1S,2R,3aR,4S,6aR)-2-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-[(2-amino-3-fluoroquinolin-7-yl)methyl]-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol.
| Compound Name | (1S,2R,3aR,4S,6aR)-2-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-[(2-amino-3-fluoroquinolin-7-yl)methyl]-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol |
|---|---|
| PubChem CID | 156510938 |
| Molecular Formula | C24H24F2N6O2 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (1S,2R,3aR,4S,6aR)-2-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-4-[(2-amino-3-fluoroquinolin-7-yl)methyl]-2,3,3a,4,5,6-hexahydro-1H-pentalene-1,6a-diol |
| SMILES | Nc1nc2cc(C[C@@H]3CC[C@@]4(O)[C@@H]3C[C@@H](n3cc(F)c5c(N)ncnc53)[C@@H]4O)ccc2cc1F |
| InChI | InChI=1S/C24H24F2N6O2/c25-15-7-13-2-1-11(6-17(13)31-21(15)27)5-12-3-4-24(34)14(12)8-18(20(24)33)32-9-16(26)19-22(28)29-10-30-23(19)32/h1-2,6-7,9-10,12,14,18,20,33-34H,3-5,8H2,(H2,27,31)(H2,28,29,30)/t12-,14+,18+,20-,24+/m0/s1 |
| InChIKey | ZAJACGXZJMZOJG-IHTMZYJLSA-N |
| XLogP | 2.73 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |