C18H18FN3O2 — CID 156511242
N-[(3Z,5E)-6-[2-(2-fluoroanilino)-1,3-oxazol-5-yl]hepta-1,3,5-trien-2-yl]acetamide (PubChem CID 156511242) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is N-[(3Z,5E)-6-[2-(2-fluoroanilino)-1,3-oxazol-5-yl]hepta-1,3,5-trien-2-yl]acetamide.
| Compound Name | N-[(3Z,5E)-6-[2-(2-fluoroanilino)-1,3-oxazol-5-yl]hepta-1,3,5-trien-2-yl]acetamide |
|---|---|
| PubChem CID | 156511242 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[(3Z,5E)-6-[2-(2-fluoroanilino)-1,3-oxazol-5-yl]hepta-1,3,5-trien-2-yl]acetamide |
| SMILES | C=C(/C=C\C=C(/C)c1cnc(Nc2ccccc2F)o1)NC(C)=O |
| InChI | InChI=1S/C18H18FN3O2/c1-12(7-6-8-13(2)21-14(3)23)17-11-20-18(24-17)22-16-10-5-4-9-15(16)19/h4-11H,2H2,1,3H3,(H,20,22)(H,21,23)/b8-6-,12-7+ |
| InChIKey | JXFGJSSTBKGPSW-LQNKLOEDSA-N |
| XLogP | 4.17 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|