C27H37N5 — CID 156511272
(3aR,6aS)-N-[5-(1,3-dimethylpyrazol-4-yl)-2-pyridinyl]-2-[(3-methyl-1-bicyclo[3.2.1]oct-5-enyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 156511272) has the molecular formula C27H37N5 and a molecular weight of 431.63 g/mol. Its IUPAC name is (3aR,6aS)-N-[5-(1,3-dimethylpyrazol-4-yl)-2-pyridinyl]-2-[(3-methyl-1-bicyclo[3.2.1]oct-5-enyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-N-[5-(1,3-dimethylpyrazol-4-yl)-2-pyridinyl]-2-[(3-methyl-1-bicyclo[3.2.1]oct-5-enyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 156511272 |
| Molecular Formula | C27H37N5 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | (3aR,6aS)-N-[5-(1,3-dimethylpyrazol-4-yl)-2-pyridinyl]-2-[(3-methyl-1-bicyclo[3.2.1]oct-5-enyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Cc1nn(C)cc1-c1ccc(NC2C[C@@H]3CN(CC45CC=C(CC(C)C4)C5)C[C@@H]3C2)nc1 |
| InChI | InChI=1S/C27H37N5/c1-18-8-20-6-7-27(11-18,12-20)17-32-14-22-9-24(10-23(22)15-32)29-26-5-4-21(13-28-26)25-16-31(3)30-19(25)2/h4-6,13,16,18,22-24H,7-12,14-15,17H2,1-3H3,(H,28,29)/t18?,22-,23+,24?,27? |
| InChIKey | MJDMCPFTYYWHKN-HSZHNZKPSA-N |
| XLogP | 5.05 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|