C22H21Cl2N3O3 — CID 156512363
(3E)-5-[bis(3-chlorophenyl)methyl]-3-(1-hydroxy-2-oxopropylidene)-1-methyl-4-(methylideneamino)piperazin-2-one (PubChem CID 156512363) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is (3E)-5-[bis(3-chlorophenyl)methyl]-3-(1-hydroxy-2-oxopropylidene)-1-methyl-4-(methylideneamino)piperazin-2-one.
| Compound Name | (3E)-5-[bis(3-chlorophenyl)methyl]-3-(1-hydroxy-2-oxopropylidene)-1-methyl-4-(methylideneamino)piperazin-2-one |
|---|---|
| PubChem CID | 156512363 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (3E)-5-[bis(3-chlorophenyl)methyl]-3-(1-hydroxy-2-oxopropylidene)-1-methyl-4-(methylideneamino)piperazin-2-one |
| SMILES | C=NN1/C(=C(/O)C(C)=O)C(=O)N(C)CC1C(c1cccc(Cl)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H21Cl2N3O3/c1-13(28)21(29)20-22(30)26(3)12-18(27(20)25-2)19(14-6-4-8-16(23)10-14)15-7-5-9-17(24)11-15/h4-11,18-19,29H,2,12H2,1,3H3/b21-20+ |
| InChIKey | ADZXLFCYXFBYSP-QZQOTICOSA-N |
| XLogP | 4.24 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|