C19H16ClN5O3 — CID 156513223
6-(4-chlorophenyl)-N-[(2S)-1-hydroxy-3-iminopropan-2-yl]-3-oxo-2-pyridin-3-ylpyridazine-4-carboxamide (PubChem CID 156513223) has the molecular formula C19H16ClN5O3 and a molecular weight of 397.82 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N-[(2S)-1-hydroxy-3-iminopropan-2-yl]-3-oxo-2-pyridin-3-ylpyridazine-4-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-N-[(2S)-1-hydroxy-3-iminopropan-2-yl]-3-oxo-2-pyridin-3-ylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 156513223 |
| Molecular Formula | C19H16ClN5O3 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 6-(4-chlorophenyl)-N-[(2S)-1-hydroxy-3-iminopropan-2-yl]-3-oxo-2-pyridin-3-ylpyridazine-4-carboxamide |
| SMILES | [H]/N=C/[C@@H](CO)NC(=O)c1cc(-c2ccc(Cl)cc2)nn(-c2cccnc2)c1=O |
| InChI | InChI=1S/C19H16ClN5O3/c20-13-5-3-12(4-6-13)17-8-16(18(27)23-14(9-21)11-26)19(28)25(24-17)15-2-1-7-22-10-15/h1-10,14,21,26H,11H2,(H,23,27)/b21-9+/t14-/m0/s1 |
| InChIKey | HUDKIATWZFFXGF-SLSPDHCBSA-N |
| XLogP | 1.69 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|