About 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine
8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 156513315) has the molecular formula C14H22N4
and a molecular weight of 246.36 g/mol. Its IUPAC name is 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine.
Molecular Properties
| Compound Name | 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine |
| PubChem CID | 156513315 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCc1nc(NC(C)C)cn2c(C(C)C)cnc12 |
| InChI | InChI=1S/C14H22N4/c1-6-11-14-15-7-12(9(2)3)18(14)8-13(17-11)16-10(4)5/h7-10,16H,6H2,1-5H3 |
| InChIKey | BHCWWWJVTPKLEL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine?
The IUPAC name of 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine (CID 156513315) is 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine.
What is the SMILES notation for 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine?
The canonical SMILES for 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine is CCc1nc(NC(C)C)cn2c(C(C)C)cnc12.
What is the InChIKey of 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine?
The InChIKey is BHCWWWJVTPKLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4/c1-6-11-14-15-7-12(9(2)3)18(14)8-13(17-11)16-10(4)5/h7-10,16H,6H2,1-5H3.
What are the key properties of 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine?
8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine has a molecular weight of 246.36 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-N,3-di(propan-2-yl)imidazo[1,2-a]pyrazin-6-amine is sourced from PubChem (CID 156513315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).