C15H21F2N3O2 — CID 156514346
tert-butyl-[4-[1-(difluoromethyl)pyrazol-4-yl]cyclohex-3-en-1-yl]carbamic acid (PubChem CID 156514346) has the molecular formula C15H21F2N3O2 and a molecular weight of 313.35 g/mol. Its IUPAC name is tert-butyl-[4-[1-(difluoromethyl)pyrazol-4-yl]cyclohex-3-en-1-yl]carbamic acid.
| Compound Name | tert-butyl-[4-[1-(difluoromethyl)pyrazol-4-yl]cyclohex-3-en-1-yl]carbamic acid |
|---|---|
| PubChem CID | 156514346 |
| Molecular Formula | C15H21F2N3O2 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | tert-butyl-[4-[1-(difluoromethyl)pyrazol-4-yl]cyclohex-3-en-1-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CC=C(c2cnn(C(F)F)c2)CC1 |
| InChI | InChI=1S/C15H21F2N3O2/c1-15(2,3)20(14(21)22)12-6-4-10(5-7-12)11-8-18-19(9-11)13(16)17/h4,8-9,12-13H,5-7H2,1-3H3,(H,21,22) |
| InChIKey | GZVURLVBZMYPGN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |