C15H22N2O2 — CID 156514453
[4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperazin-1-yl]-(2-hydroxycyclopropyl)methanone (PubChem CID 156514453) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperazin-1-yl]-(2-hydroxycyclopropyl)methanone.
| Compound Name | [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperazin-1-yl]-(2-hydroxycyclopropyl)methanone |
|---|---|
| PubChem CID | 156514453 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | [4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperazin-1-yl]-(2-hydroxycyclopropyl)methanone |
| SMILES | C=C/C=C(\C=C/C)N1CCN(C(=O)C2CC2O)CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-5-12(6-4-2)16-7-9-17(10-8-16)15(19)13-11-14(13)18/h3-6,13-14,18H,1,7-11H2,2H3/b6-4-,12-5+ |
| InChIKey | JRHWLDRYYPFZNB-GLNLJRCCSA-N |
| XLogP | 1.16 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|