About [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine
[2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine (PubChem CID 15651506) has the molecular formula C11H25ClN3O5P
and a molecular weight of 345.76 g/mol. Its IUPAC name is [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine.
Molecular Properties
| Compound Name | [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine |
| PubChem CID | 15651506 |
| Molecular Formula | C11H25ClN3O5P |
| Molecular Weight | 345.76 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine |
| SMILES | CCCCCCCCN.NC(=O)NC(=O)C(Cl)P(=O)(O)O |
| InChI | InChI=1S/C8H19N.C3H6ClN2O5P/c1-2-3-4-5-6-7-8-9;4-1(12(9,10)11)2(7)6-3(5)8/h2-9H2,1H3;1H,(H2,9,10,11)(H3,5,6,7,8) |
| InChIKey | VBPKUOGDCKJUEC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.76 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine?
The IUPAC name of [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine (CID 15651506) is [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine.
What is the SMILES notation for [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine?
The canonical SMILES for [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine is CCCCCCCCN.NC(=O)NC(=O)C(Cl)P(=O)(O)O.
What is the InChIKey of [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine?
The InChIKey is VBPKUOGDCKJUEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C3H6ClN2O5P/c1-2-3-4-5-6-7-8-9;4-1(12(9,10)11)2(7)6-3(5)8/h2-9H2,1H3;1H,(H2,9,10,11)(H3,5,6,7,8).
What are the key properties of [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine?
[2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine has a molecular weight of 345.76 g/mol, XLogP of 1.23, 8 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(carbamoylamino)-1-chloro-2-oxoethyl]phosphonic acid;octan-1-amine is sourced from PubChem (CID 15651506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).