About 3-prop-1-en-2-yl-1,2,4-thiadiazole
3-prop-1-en-2-yl-1,2,4-thiadiazole (PubChem CID 156515761) has the molecular formula C5H6N2S
and a molecular weight of 126.18 g/mol. Its IUPAC name is 3-prop-1-en-2-yl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-prop-1-en-2-yl-1,2,4-thiadiazole |
| PubChem CID | 156515761 |
| Molecular Formula | C5H6N2S |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 3-prop-1-en-2-yl-1,2,4-thiadiazole |
| SMILES | C=C(C)c1ncsn1 |
| InChI | InChI=1S/C5H6N2S/c1-4(2)5-6-3-8-7-5/h3H,1H2,2H3 |
| InChIKey | REAOSBNDMXBPHE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-prop-1-en-2-yl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-1-en-2-yl-1,2,4-thiadiazole?
The IUPAC name of 3-prop-1-en-2-yl-1,2,4-thiadiazole (CID 156515761) is 3-prop-1-en-2-yl-1,2,4-thiadiazole.
What is the SMILES notation for 3-prop-1-en-2-yl-1,2,4-thiadiazole?
The canonical SMILES for 3-prop-1-en-2-yl-1,2,4-thiadiazole is C=C(C)c1ncsn1.
What is the InChIKey of 3-prop-1-en-2-yl-1,2,4-thiadiazole?
The InChIKey is REAOSBNDMXBPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2S/c1-4(2)5-6-3-8-7-5/h3H,1H2,2H3.
What are the key properties of 3-prop-1-en-2-yl-1,2,4-thiadiazole?
3-prop-1-en-2-yl-1,2,4-thiadiazole has a molecular weight of 126.18 g/mol, XLogP of 1.57, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-1-en-2-yl-1,2,4-thiadiazole is sourced from PubChem (CID 156515761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).