About 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide
3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide (PubChem CID 15651591) has the molecular formula C11H22F2N2O2
and a molecular weight of 252.30 g/mol. Its IUPAC name is 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide.
Molecular Properties
| Compound Name | 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide |
| PubChem CID | 15651591 |
| Molecular Formula | C11H22F2N2O2 |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide |
| SMILES | CCOC(N(C)C)C(F)(F)C(=O)N(CC)CC |
| InChI | InChI=1S/C11H22F2N2O2/c1-6-15(7-2)9(16)11(12,13)10(14(4)5)17-8-3/h10H,6-8H2,1-5H3 |
| InChIKey | HVWOINZZSFVTII-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide?
The IUPAC name of 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide (CID 15651591) is 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide.
What is the SMILES notation for 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide?
The canonical SMILES for 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide is CCOC(N(C)C)C(F)(F)C(=O)N(CC)CC.
What is the InChIKey of 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide?
The InChIKey is HVWOINZZSFVTII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2O2/c1-6-15(7-2)9(16)11(12,13)10(14(4)5)17-8-3/h10H,6-8H2,1-5H3.
What are the key properties of 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide?
3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide has a molecular weight of 252.30 g/mol, XLogP of 1.41, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-3-ethoxy-N,N-diethyl-2,2-difluoropropanamide is sourced from PubChem (CID 15651591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).