C13H14F2N2O3 — CID 156516055
1-[3,3-difluoro-4-(4-nitrophenyl)piperidin-1-yl]ethanone (PubChem CID 156516055) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 1-[3,3-difluoro-4-(4-nitrophenyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[3,3-difluoro-4-(4-nitrophenyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 156516055 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-[3,3-difluoro-4-(4-nitrophenyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2ccc([N+](=O)[O-])cc2)C(F)(F)C1 |
| InChI | InChI=1S/C13H14F2N2O3/c1-9(18)16-7-6-12(13(14,15)8-16)10-2-4-11(5-3-10)17(19)20/h2-5,12H,6-8H2,1H3 |
| InChIKey | ZVOAHXQIDDJWCQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|