C12H6F13N — CID 15651619
2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline (PubChem CID 15651619) has the molecular formula C12H6F13N and a molecular weight of 411.16 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline |
|---|---|
| PubChem CID | 15651619 |
| Molecular Formula | C12H6F13N |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)aniline |
| SMILES | Nc1ccccc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F13N/c13-7(14,5-3-1-2-4-6(5)26)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h1-4H,26H2 |
| InChIKey | ZLFYREKELVEJOR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|