C36H39F2N3O4 — CID 156516190
tert-butyl 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]piperidin-4-yl]acetate (PubChem CID 156516190) has the molecular formula C36H39F2N3O4 and a molecular weight of 615.72 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]piperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 156516190 |
| Molecular Formula | C36H39F2N3O4 |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | tert-butyl 2-[1-[4-[[2,6-bis(phenylmethoxy)-3-pyridinyl]amino]-2,6-difluorophenyl]piperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCN(c2c(F)cc(Nc3ccc(OCc4ccccc4)nc3OCc3ccccc3)cc2F)CC1 |
| InChI | InChI=1S/C36H39F2N3O4/c1-36(2,3)45-33(42)20-25-16-18-41(19-17-25)34-29(37)21-28(22-30(34)38)39-31-14-15-32(43-23-26-10-6-4-7-11-26)40-35(31)44-24-27-12-8-5-9-13-27/h4-15,21-22,25,39H,16-20,23-24H2,1-3H3 |
| InChIKey | VRJDFEFRGRRUBW-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|