C14H20N4O2 — CID 156516198
ethyl 2-[(2E)-2-but-3-en-2-ylidenehydrazinyl]-2-(6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl)acetate (PubChem CID 156516198) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is ethyl 2-[(2E)-2-but-3-en-2-ylidenehydrazinyl]-2-(6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl)acetate.
| Compound Name | ethyl 2-[(2E)-2-but-3-en-2-ylidenehydrazinyl]-2-(6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl)acetate |
|---|---|
| PubChem CID | 156516198 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | ethyl 2-[(2E)-2-but-3-en-2-ylidenehydrazinyl]-2-(6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl)acetate |
| SMILES | C=C/C(C)=N/NC(C(=O)OCC)c1ncn2c1CCC2 |
| InChI | InChI=1S/C14H20N4O2/c1-4-10(3)16-17-13(14(19)20-5-2)12-11-7-6-8-18(11)9-15-12/h4,9,13,17H,1,5-8H2,2-3H3/b16-10+ |
| InChIKey | LVUHUOZZHKZTTK-MHWRWJLKSA-N |
| XLogP | 1.59 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|