About (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid
(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid (PubChem CID 156516507) has the molecular formula C11H11F3O3
and a molecular weight of 248.20 g/mol. Its IUPAC name is (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid.
Molecular Properties
| Compound Name | (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid |
| PubChem CID | 156516507 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid |
| SMILES | C/C=C1/C=C(C(=O)O)C(C(F)(F)F)O/C1=C/C |
| InChI | InChI=1S/C11H11F3O3/c1-3-6-5-7(10(15)16)9(11(12,13)14)17-8(6)4-2/h3-5,9H,1-2H3,(H,15,16)/b6-3-,8-4+ |
| InChIKey | CIQJIUPRLWUKLX-TTZRGRENSA-N |
| XLogP | 2.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid?
The IUPAC name of (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid (CID 156516507) is (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid.
What is the SMILES notation for (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid?
The canonical SMILES for (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid is C/C=C1/C=C(C(=O)O)C(C(F)(F)F)O/C1=C/C.
What is the InChIKey of (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid?
The InChIKey is CIQJIUPRLWUKLX-TTZRGRENSA-N. The full InChI is InChI=1S/C11H11F3O3/c1-3-6-5-7(10(15)16)9(11(12,13)14)17-8(6)4-2/h3-5,9H,1-2H3,(H,15,16)/b6-3-,8-4+.
What are the key properties of (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid?
(5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid has a molecular weight of 248.20 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6E)-5,6-di(ethylidene)-2-(trifluoromethyl)-2H-pyran-3-carboxylic acid is sourced from PubChem (CID 156516507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).