C26H34N10 — CID 156516557
4-[3-[3-aminopropyl(methyl)amino]propylamino]-2-benzyl-N'-(methyldiazenyl)-9H-pyrimido[4,5-b]indole-7-carboximidamide (PubChem CID 156516557) has the molecular formula C26H34N10 and a molecular weight of 486.63 g/mol. Its IUPAC name is 4-[3-[3-aminopropyl(methyl)amino]propylamino]-2-benzyl-N'-(methyldiazenyl)-9H-pyrimido[4,5-b]indole-7-carboximidamide.
| Compound Name | 4-[3-[3-aminopropyl(methyl)amino]propylamino]-2-benzyl-N'-(methyldiazenyl)-9H-pyrimido[4,5-b]indole-7-carboximidamide |
|---|---|
| PubChem CID | 156516557 |
| Molecular Formula | C26H34N10 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 4-[3-[3-aminopropyl(methyl)amino]propylamino]-2-benzyl-N'-(methyldiazenyl)-9H-pyrimido[4,5-b]indole-7-carboximidamide |
| SMILES | C/N=N/N=C(\N)c1ccc2c(c1)[nH]c1nc(Cc3ccccc3)nc(NCCCN(C)CCCN)c12 |
| InChI | InChI=1S/C26H34N10/c1-29-35-34-24(28)19-10-11-20-21(17-19)31-26-23(20)25(30-13-7-15-36(2)14-6-12-27)32-22(33-26)16-18-8-4-3-5-9-18/h3-5,8-11,17H,6-7,12-16,27H2,1-2H3,(H2,28,29,34)(H2,30,31,32,33) |
| InChIKey | ZCPSPIITSARJSF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 145.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|