About 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine
3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine (PubChem CID 156516565) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine.
Molecular Properties
| Compound Name | 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine |
| PubChem CID | 156516565 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine |
| SMILES | C=C(N)/C(C)=N/C1=C(C)CN(C)CC1 |
| InChI | InChI=1S/C11H19N3/c1-8-7-14(4)6-5-11(8)13-10(3)9(2)12/h2,5-7,12H2,1,3-4H3/b13-10+ |
| InChIKey | LHMQYVPOHMOISZ-JLHYYAGUSA-N |
| XLogP | 1.53 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine?
The IUPAC name of 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine (CID 156516565) is 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine.
What is the SMILES notation for 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine?
The canonical SMILES for 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine is C=C(N)/C(C)=N/C1=C(C)CN(C)CC1.
What is the InChIKey of 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine?
The InChIKey is LHMQYVPOHMOISZ-JLHYYAGUSA-N. The full InChI is InChI=1S/C11H19N3/c1-8-7-14(4)6-5-11(8)13-10(3)9(2)12/h2,5-7,12H2,1,3-4H3/b13-10+.
What are the key properties of 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine?
3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine has a molecular weight of 193.29 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)imino]but-1-en-2-amine is sourced from PubChem (CID 156516565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).