About 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine
3-N,4-N,5-trimethylhex-1-ene-3,4-diimine (PubChem CID 156516578) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine.
Molecular Properties
| Compound Name | 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine |
| PubChem CID | 156516578 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine |
| SMILES | C=CC(=N\C)/C(=N/C)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-6-8(10-4)9(11-5)7(2)3/h6-7H,1H2,2-5H3/b10-8+,11-9+ |
| InChIKey | URBOQAUUEDGNKA-GFULKKFKSA-N |
| XLogP | 1.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine?
The IUPAC name of 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine (CID 156516578) is 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine.
What is the SMILES notation for 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine?
The canonical SMILES for 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine is C=CC(=N\C)/C(=N/C)C(C)C.
What is the InChIKey of 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine?
The InChIKey is URBOQAUUEDGNKA-GFULKKFKSA-N. The full InChI is InChI=1S/C9H16N2/c1-6-8(10-4)9(11-5)7(2)3/h6-7H,1H2,2-5H3/b10-8+,11-9+.
What are the key properties of 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine?
3-N,4-N,5-trimethylhex-1-ene-3,4-diimine has a molecular weight of 152.24 g/mol, XLogP of 1.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,4-N,5-trimethylhex-1-ene-3,4-diimine is sourced from PubChem (CID 156516578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).