C22H26F2N6O2 — CID 156516589
(11R)-N-(3-cyano-2,4-difluorophenyl)-11-[(1S)-1-hydroxypropyl]-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide (PubChem CID 156516589) has the molecular formula C22H26F2N6O2 and a molecular weight of 444.49 g/mol. Its IUPAC name is (11R)-N-(3-cyano-2,4-difluorophenyl)-11-[(1S)-1-hydroxypropyl]-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide.
| Compound Name | (11R)-N-(3-cyano-2,4-difluorophenyl)-11-[(1S)-1-hydroxypropyl]-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
|---|---|
| PubChem CID | 156516589 |
| Molecular Formula | C22H26F2N6O2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (11R)-N-(3-cyano-2,4-difluorophenyl)-11-[(1S)-1-hydroxypropyl]-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxamide |
| SMILES | CC[C@H](O)[C@@H]1CN(C)Cc2c3c(nn2C1)CCN(C(=O)Nc1ccc(F)c(C#N)c1F)C3 |
| InChI | InChI=1S/C22H26F2N6O2/c1-3-20(31)13-9-28(2)12-19-15-11-29(7-6-17(15)27-30(19)10-13)22(32)26-18-5-4-16(23)14(8-25)21(18)24/h4-5,13,20,31H,3,6-7,9-12H2,1-2H3,(H,26,32)/t13-,20+/m1/s1 |
| InChIKey | OJUTWVBACZASTB-XCLFUZPHSA-N |
| XLogP | 2.46 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |