C9H13F9O3Si — CID 15651659
trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane (PubChem CID 15651659) has the molecular formula C9H13F9O3Si and a molecular weight of 368.27 g/mol. Its IUPAC name is trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane.
| Compound Name | trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 15651659 |
| Molecular Formula | C9H13F9O3Si |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| SMILES | CO[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OC)OC |
| InChI | InChI=1S/C9H13F9O3Si/c1-19-22(20-2,21-3)5-4-6(10,11)7(12,13)8(14,15)9(16,17)18/h4-5H2,1-3H3 |
| InChIKey | IJROHELDTBDTPH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|